C11H20N2O3 — CID 102893232
N-(1,3-dihydroxypropan-2-yl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 102893232) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 102893232 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C(NC(CO)CO)C1NCC2CCCC21 |
| InChI | InChI=1S/C11H20N2O3/c14-5-8(6-15)13-11(16)10-9-3-1-2-7(9)4-12-10/h7-10,12,14-15H,1-6H2,(H,13,16) |
| InChIKey | ZSOZIKXHKGKCPW-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |