C9H17NO4S — CID 78996641
(2R)-2-(cyclopropylsulfonylamino)-4-methylpentanoic acid (PubChem CID 78996641) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is (2R)-2-(cyclopropylsulfonylamino)-4-methylpentanoic acid.
| Compound Name | (2R)-2-(cyclopropylsulfonylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78996641 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | (2R)-2-(cyclopropylsulfonylamino)-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NS(=O)(=O)C1CC1)C(=O)O |
| InChI | InChI=1S/C9H17NO4S/c1-6(2)5-8(9(11)12)10-15(13,14)7-3-4-7/h6-8,10H,3-5H2,1-2H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | DAEGCRADLPPMLS-MRVPVSSYSA-N |
| XLogP | 0.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |