C7H13NO5S — CID 104935303
(2S,3R)-2-(cyclopropylsulfonylamino)-3-hydroxybutanoic acid (PubChem CID 104935303) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is (2S,3R)-2-(cyclopropylsulfonylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(cyclopropylsulfonylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104935303 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (2S,3R)-2-(cyclopropylsulfonylamino)-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NS(=O)(=O)C1CC1)C(=O)O |
| InChI | InChI=1S/C7H13NO5S/c1-4(9)6(7(10)11)8-14(12,13)5-2-3-5/h4-6,8-9H,2-3H2,1H3,(H,10,11)/t4-,6+/m1/s1 |
| InChIKey | KHOREOOIWNUDGL-XINAWCOVSA-N |
| XLogP | -1.10 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |