C10H17NO7S — CID 140895558
(2S,3S)-3-hydroxy-2-[(3-sulfocyclopentanecarbonyl)amino]butanoic acid (PubChem CID 140895558) has the molecular formula C10H17NO7S and a molecular weight of 295.31 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-[(3-sulfocyclopentanecarbonyl)amino]butanoic acid.
| Compound Name | (2S,3S)-3-hydroxy-2-[(3-sulfocyclopentanecarbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 140895558 |
| Molecular Formula | C10H17NO7S |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-[(3-sulfocyclopentanecarbonyl)amino]butanoic acid |
| SMILES | C[C@H](O)[C@H](NC(=O)C1CCC(S(=O)(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C10H17NO7S/c1-5(12)8(10(14)15)11-9(13)6-2-3-7(4-6)19(16,17)18/h5-8,12H,2-4H2,1H3,(H,11,13)(H,14,15)(H,16,17,18)/t5-,6?,7?,8-/m0/s1 |
| InChIKey | WVGASZXIQKBZAT-UMULYZNJSA-N |
| XLogP | -1.01 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|