C15H19NO7S — CID 146875903
(2S)-3-(4-hydroxyphenyl)-2-[[(1S,3S)-3-sulfocyclopentanecarbonyl]amino]propanoic acid (PubChem CID 146875903) has the molecular formula C15H19NO7S and a molecular weight of 357.38 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-[[(1S,3S)-3-sulfocyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-[[(1S,3S)-3-sulfocyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146875903 |
| Molecular Formula | C15H19NO7S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[[(1S,3S)-3-sulfocyclopentanecarbonyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@H]1CC[C@H](S(=O)(=O)O)C1 |
| InChI | InChI=1S/C15H19NO7S/c17-11-4-1-9(2-5-11)7-13(15(19)20)16-14(18)10-3-6-12(8-10)24(21,22)23/h1-2,4-5,10,12-13,17H,3,6-8H2,(H,16,18)(H,19,20)(H,21,22,23)/t10-,12-,13-/m0/s1 |
| InChIKey | SQMXSAHZTBRYHM-DRZSPHRISA-N |
| XLogP | 0.56 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|