C14H18N2O4 — CID 104905636
(2R)-3-(4-hydroxyphenyl)-2-(pyrrolidine-3-carbonylamino)propanoic acid (PubChem CID 104905636) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2R)-3-(4-hydroxyphenyl)-2-(pyrrolidine-3-carbonylamino)propanoic acid.
| Compound Name | (2R)-3-(4-hydroxyphenyl)-2-(pyrrolidine-3-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 104905636 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2R)-3-(4-hydroxyphenyl)-2-(pyrrolidine-3-carbonylamino)propanoic acid |
| SMILES | O=C(N[C@H](Cc1ccc(O)cc1)C(=O)O)C1CCNC1 |
| InChI | InChI=1S/C14H18N2O4/c17-11-3-1-9(2-4-11)7-12(14(19)20)16-13(18)10-5-6-15-8-10/h1-4,10,12,15,17H,5-8H2,(H,16,18)(H,19,20)/t10?,12-/m1/s1 |
| InChIKey | MBGGLXIRNURSEY-TVKKRMFBSA-N |
| XLogP | 0.11 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |