C6H13NO5S — CID 16776843
2-(ethylsulfonylamino)-3-hydroxybutanoic acid (PubChem CID 16776843) has the molecular formula C6H13NO5S and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-(ethylsulfonylamino)-3-hydroxybutanoic acid.
| Compound Name | 2-(ethylsulfonylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 16776843 |
| Molecular Formula | C6H13NO5S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2-(ethylsulfonylamino)-3-hydroxybutanoic acid |
| SMILES | CCS(=O)(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C6H13NO5S/c1-3-13(11,12)7-5(4(2)8)6(9)10/h4-5,7-8H,3H2,1-2H3,(H,9,10) |
| InChIKey | BJFVJZBXYPTNDK-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |