C8H16N2O5S — CID 28783815
(2S,3R)-3-hydroxy-2-(pyrrolidin-1-ylsulfonylamino)butanoic acid (PubChem CID 28783815) has the molecular formula C8H16N2O5S and a molecular weight of 252.29 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(pyrrolidin-1-ylsulfonylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(pyrrolidin-1-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 28783815 |
| Molecular Formula | C8H16N2O5S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(pyrrolidin-1-ylsulfonylamino)butanoic acid |
| SMILES | C[C@@H](O)[C@H](NS(=O)(=O)N1CCCC1)C(=O)O |
| InChI | InChI=1S/C8H16N2O5S/c1-6(11)7(8(12)13)9-16(14,15)10-4-2-3-5-10/h6-7,9,11H,2-5H2,1H3,(H,12,13)/t6-,7+/m1/s1 |
| InChIKey | CSCKUZRYBINLOH-RQJHMYQMSA-N |
| XLogP | -1.25 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |