C10H20N2O4S — CID 28784129
(2S,3S)-3-methyl-2-(pyrrolidin-1-ylsulfonylamino)pentanoic acid (PubChem CID 28784129) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(pyrrolidin-1-ylsulfonylamino)pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-(pyrrolidin-1-ylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 28784129 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (2S,3S)-3-methyl-2-(pyrrolidin-1-ylsulfonylamino)pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NS(=O)(=O)N1CCCC1)C(=O)O |
| InChI | InChI=1S/C10H20N2O4S/c1-3-8(2)9(10(13)14)11-17(15,16)12-6-4-5-7-12/h8-9,11H,3-7H2,1-2H3,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | PPGGGRSOZWVGEX-IUCAKERBSA-N |
| XLogP | 0.42 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |