C9H20N2O4S — CID 104977898
(2S)-3-methyl-2-(propan-2-ylsulfamoylamino)pentanoic acid (PubChem CID 104977898) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is (2S)-3-methyl-2-(propan-2-ylsulfamoylamino)pentanoic acid.
| Compound Name | (2S)-3-methyl-2-(propan-2-ylsulfamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 104977898 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2S)-3-methyl-2-(propan-2-ylsulfamoylamino)pentanoic acid |
| SMILES | CCC(C)[C@H](NS(=O)(=O)NC(C)C)C(=O)O |
| InChI | InChI=1S/C9H20N2O4S/c1-5-7(4)8(9(12)13)11-16(14,15)10-6(2)3/h6-8,10-11H,5H2,1-4H3,(H,12,13)/t7?,8-/m0/s1 |
| InChIKey | UPCWOJXPCUEPSW-MQWKRIRWSA-N |
| XLogP | 0.32 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |