C7H13F2NO4S — CID 61173996
(2S)-2-(difluoromethylsulfonylamino)-3-methylpentanoic acid (PubChem CID 61173996) has the molecular formula C7H13F2NO4S and a molecular weight of 245.25 g/mol. Its IUPAC name is (2S)-2-(difluoromethylsulfonylamino)-3-methylpentanoic acid.
| Compound Name | (2S)-2-(difluoromethylsulfonylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 61173996 |
| Molecular Formula | C7H13F2NO4S |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (2S)-2-(difluoromethylsulfonylamino)-3-methylpentanoic acid |
| SMILES | CCC(C)[C@H](NS(=O)(=O)C(F)F)C(=O)O |
| InChI | InChI=1S/C7H13F2NO4S/c1-3-4(2)5(6(11)12)10-15(13,14)7(8)9/h4-5,7,10H,3H2,1-2H3,(H,11,12)/t4?,5-/m0/s1 |
| InChIKey | WLCJMTJPWFGPEN-AKGZTFGVSA-N |
| XLogP | 0.63 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |