C14H25NO4S — CID 163654700
3-methyl-2-[[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl]sulfonylamino]pentanoic acid (PubChem CID 163654700) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is 3-methyl-2-[[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl]sulfonylamino]pentanoic acid.
| Compound Name | 3-methyl-2-[[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl]sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 163654700 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-methyl-2-[[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl]sulfonylamino]pentanoic acid |
| SMILES | C/C=C(C)\C=C/C(C)S(=O)(=O)NC(C(=O)O)C(C)CC |
| InChI | InChI=1S/C14H25NO4S/c1-6-10(3)8-9-12(5)20(18,19)15-13(14(16)17)11(4)7-2/h6,8-9,11-13,15H,7H2,1-5H3,(H,16,17)/b9-8-,10-6- |
| InChIKey | IPERFRHZUMIIAS-BLQKWXTKSA-N |
| XLogP | 2.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|