C10H22N2O4S — CID 104978587
(2S,3S)-3-methyl-2-(2-methylpropylsulfamoylamino)pentanoic acid (PubChem CID 104978587) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(2-methylpropylsulfamoylamino)pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-(2-methylpropylsulfamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 104978587 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2S,3S)-3-methyl-2-(2-methylpropylsulfamoylamino)pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NS(=O)(=O)NCC(C)C)C(=O)O |
| InChI | InChI=1S/C10H22N2O4S/c1-5-8(4)9(10(13)14)12-17(15,16)11-6-7(2)3/h7-9,11-12H,5-6H2,1-4H3,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | BGBACZUCZMNRSQ-IUCAKERBSA-N |
| XLogP | 0.57 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |