C10H22N2O4S — CID 54947569
(2S)-3-methyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentanoic acid (PubChem CID 54947569) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentanoic acid.
| Compound Name | (2S)-3-methyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54947569 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2S)-3-methyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentanoic acid |
| SMILES | CCC(C)[C@H](NS(=O)(=O)N(C)C(C)C)C(=O)O |
| InChI | InChI=1S/C10H22N2O4S/c1-6-8(4)9(10(13)14)11-17(15,16)12(5)7(2)3/h7-9,11H,6H2,1-5H3,(H,13,14)/t8?,9-/m0/s1 |
| InChIKey | ADSZENVRHZILDE-GKAPJAKFSA-N |
| XLogP | 0.66 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |