C8H18N2O4S — CID 61455877
2-[[methyl(propan-2-yl)sulfamoyl]amino]butanoic acid (PubChem CID 61455877) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-[[methyl(propan-2-yl)sulfamoyl]amino]butanoic acid.
| Compound Name | 2-[[methyl(propan-2-yl)sulfamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 61455877 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-[[methyl(propan-2-yl)sulfamoyl]amino]butanoic acid |
| SMILES | CCC(NS(=O)(=O)N(C)C(C)C)C(=O)O |
| InChI | InChI=1S/C8H18N2O4S/c1-5-7(8(11)12)9-15(13,14)10(4)6(2)3/h6-7,9H,5H2,1-4H3,(H,11,12) |
| InChIKey | NRKJSOZOXRDXPK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |