C8H16N2O6S — CID 114462104
2-(propan-2-yloxycarbonylsulfamoylamino)butanoic acid (PubChem CID 114462104) has the molecular formula C8H16N2O6S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-(propan-2-yloxycarbonylsulfamoylamino)butanoic acid.
| Compound Name | 2-(propan-2-yloxycarbonylsulfamoylamino)butanoic acid |
|---|---|
| PubChem CID | 114462104 |
| Molecular Formula | C8H16N2O6S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-(propan-2-yloxycarbonylsulfamoylamino)butanoic acid |
| SMILES | CCC(NS(=O)(=O)NC(=O)OC(C)C)C(=O)O |
| InChI | InChI=1S/C8H16N2O6S/c1-4-6(7(11)12)9-17(14,15)10-8(13)16-5(2)3/h5-6,9H,4H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | QDFVTGVOZNGKHQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |