C11H22N2O6S — CID 114463001
4,4-dimethyl-3-(propan-2-yloxycarbonylsulfamoylamino)pentanoic acid (PubChem CID 114463001) has the molecular formula C11H22N2O6S and a molecular weight of 310.37 g/mol. Its IUPAC name is 4,4-dimethyl-3-(propan-2-yloxycarbonylsulfamoylamino)pentanoic acid.
| Compound Name | 4,4-dimethyl-3-(propan-2-yloxycarbonylsulfamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 114463001 |
| Molecular Formula | C11H22N2O6S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4,4-dimethyl-3-(propan-2-yloxycarbonylsulfamoylamino)pentanoic acid |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NC(CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O6S/c1-7(2)19-10(16)13-20(17,18)12-8(6-9(14)15)11(3,4)5/h7-8,12H,6H2,1-5H3,(H,13,16)(H,14,15) |
| InChIKey | CIXOXBDSPBBJEF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |