C7H16N2O4S — CID 43631196
2-(dimethylsulfamoylamino)pentanoic acid (PubChem CID 43631196) has the molecular formula C7H16N2O4S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)pentanoic acid.
| Compound Name | 2-(dimethylsulfamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 43631196 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-(dimethylsulfamoylamino)pentanoic acid |
| SMILES | CCCC(NS(=O)(=O)N(C)C)C(=O)O |
| InChI | InChI=1S/C7H16N2O4S/c1-4-5-6(7(10)11)8-14(12,13)9(2)3/h6,8H,4-5H2,1-3H3,(H,10,11) |
| InChIKey | GZXXNPVBDDMBLY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |