C12H24N2O4S — CID 93252484
(2R)-2-[[cyclohexyl(methyl)sulfamoyl]amino]pentanoic acid (PubChem CID 93252484) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is (2R)-2-[[cyclohexyl(methyl)sulfamoyl]amino]pentanoic acid.
| Compound Name | (2R)-2-[[cyclohexyl(methyl)sulfamoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 93252484 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2R)-2-[[cyclohexyl(methyl)sulfamoyl]amino]pentanoic acid |
| SMILES | CCC[C@@H](NS(=O)(=O)N(C)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C12H24N2O4S/c1-3-7-11(12(15)16)13-19(17,18)14(2)10-8-5-4-6-9-10/h10-11,13H,3-9H2,1-2H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | LEZJGZRJCIIUSD-LLVKDONJSA-N |
| XLogP | 1.34 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |