(2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid

C11H23NO4S — CID 104934822

IUPAC(2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid
SMILESCCC[C@H](NS(=O)(=O)CCC(C)(C)C)C(=O)O
InChIInChI=1S/C11H23NO4S/c1-5-6-9(10(13)14)12-17(15,16)8-7-11(2,3)4/h9,12H,5-8H2,1-4H3,(H,13,14)/t9-/m0/s1
InChIKeyLTVZSVZLCVHQQJ-VIFPVBQESA-N
MW265.37 g/mol
LogP1.60
Rot. Bonds7

About (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid

(2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid (PubChem CID 104934822) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid.

Molecular Properties

Compound Name(2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid
PubChem CID104934822
Molecular FormulaC11H23NO4S
Molecular Weight265.37 g/mol
Exact Mass265.13
IUPAC Name(2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid
SMILESCCC[C@H](NS(=O)(=O)CCC(C)(C)C)C(=O)O
InChIInChI=1S/C11H23NO4S/c1-5-6-9(10(13)14)12-17(15,16)8-7-11(2,3)4/h9,12H,5-8H2,1-4H3,(H,13,14)/t9-/m0/s1
InChIKeyLTVZSVZLCVHQQJ-VIFPVBQESA-N
XLogP1.60
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.37
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid?
The IUPAC name of (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid (CID 104934822) is (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid.
What is the SMILES notation for (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid?
The canonical SMILES for (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid is CCC[C@H](NS(=O)(=O)CCC(C)(C)C)C(=O)O.
What is the InChIKey of (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid?
The InChIKey is LTVZSVZLCVHQQJ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H23NO4S/c1-5-6-9(10(13)14)12-17(15,16)8-7-11(2,3)4/h9,12H,5-8H2,1-4H3,(H,13,14)/t9-/m0/s1.
What are the key properties of (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid?
(2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid has a molecular weight of 265.37 g/mol, XLogP of 1.60, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3,3-dimethylbutylsulfonylamino)pentanoic acid is sourced from PubChem (CID 104934822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).