(2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid

C9H16F3NO4S — CID 122070574

IUPAC(2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid
SMILESCCCC[C@H](NS(=O)(=O)CCC(F)(F)F)C(=O)O
InChIInChI=1S/C9H16F3NO4S/c1-2-3-4-7(8(14)15)13-18(16,17)6-5-9(10,11)12/h7,13H,2-6H2,1H3,(H,14,15)/t7-/m0/s1
InChIKeyNCIZLLUNBHONIE-ZETCQYMHSA-N
MW291.29 g/mol
LogP1.50
Rot. Bonds8

About (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid

(2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid (PubChem CID 122070574) has the molecular formula C9H16F3NO4S and a molecular weight of 291.29 g/mol. Its IUPAC name is (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid.

Molecular Properties

Compound Name(2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid
PubChem CID122070574
Molecular FormulaC9H16F3NO4S
Molecular Weight291.29 g/mol
Exact Mass291.08
IUPAC Name(2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid
SMILESCCCC[C@H](NS(=O)(=O)CCC(F)(F)F)C(=O)O
InChIInChI=1S/C9H16F3NO4S/c1-2-3-4-7(8(14)15)13-18(16,17)6-5-9(10,11)12/h7,13H,2-6H2,1H3,(H,14,15)/t7-/m0/s1
InChIKeyNCIZLLUNBHONIE-ZETCQYMHSA-N
XLogP1.50
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.29
LogP ≤ 51.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid?
The IUPAC name of (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid (CID 122070574) is (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid.
What is the SMILES notation for (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid?
The canonical SMILES for (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid is CCCC[C@H](NS(=O)(=O)CCC(F)(F)F)C(=O)O.
What is the InChIKey of (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid?
The InChIKey is NCIZLLUNBHONIE-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H16F3NO4S/c1-2-3-4-7(8(14)15)13-18(16,17)6-5-9(10,11)12/h7,13H,2-6H2,1H3,(H,14,15)/t7-/m0/s1.
What are the key properties of (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid?
(2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid has a molecular weight of 291.29 g/mol, XLogP of 1.50, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3,3,3-trifluoropropylsulfonylamino)hexanoic acid is sourced from PubChem (CID 122070574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).