C9H18N2O4S — CID 122069875
(2S,3S)-2-(azetidin-1-ylsulfonylamino)-3-methylpentanoic acid (PubChem CID 122069875) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is (2S,3S)-2-(azetidin-1-ylsulfonylamino)-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-(azetidin-1-ylsulfonylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 122069875 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2S,3S)-2-(azetidin-1-ylsulfonylamino)-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NS(=O)(=O)N1CCC1)C(=O)O |
| InChI | InChI=1S/C9H18N2O4S/c1-3-7(2)8(9(12)13)10-16(14,15)11-5-4-6-11/h7-8,10H,3-6H2,1-2H3,(H,12,13)/t7-,8-/m0/s1 |
| InChIKey | SIQNOQDZVYRUFN-YUMQZZPRSA-N |
| XLogP | 0.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |