C7H12N2O5S — CID 104965148
(2S,3R)-2-(1-cyanoethylsulfonylamino)-3-hydroxybutanoic acid (PubChem CID 104965148) has the molecular formula C7H12N2O5S and a molecular weight of 236.25 g/mol. Its IUPAC name is (2S,3R)-2-(1-cyanoethylsulfonylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(1-cyanoethylsulfonylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104965148 |
| Molecular Formula | C7H12N2O5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (2S,3R)-2-(1-cyanoethylsulfonylamino)-3-hydroxybutanoic acid |
| SMILES | CC(C#N)S(=O)(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C7H12N2O5S/c1-4(3-8)15(13,14)9-6(5(2)10)7(11)12/h4-6,9-10H,1-2H3,(H,11,12)/t4?,5-,6+/m1/s1 |
| InChIKey | IBFPFHHVSVDZGT-UVCATTPVSA-N |
| XLogP | -1.35 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |