C7H14N2O3S — CID 104868962
1-cyano-N-[(2R)-1-hydroxybutan-2-yl]ethanesulfonamide (PubChem CID 104868962) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is 1-cyano-N-[(2R)-1-hydroxybutan-2-yl]ethanesulfonamide.
| Compound Name | 1-cyano-N-[(2R)-1-hydroxybutan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 104868962 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 1-cyano-N-[(2R)-1-hydroxybutan-2-yl]ethanesulfonamide |
| SMILES | CC[C@H](CO)NS(=O)(=O)C(C)C#N |
| InChI | InChI=1S/C7H14N2O3S/c1-3-7(5-10)9-13(11,12)6(2)4-8/h6-7,9-10H,3,5H2,1-2H3/t6?,7-/m1/s1 |
| InChIKey | FOTXQIJTNFAWSF-COBSHVIPSA-N |
| XLogP | -0.41 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |