C7H12N2O4S — CID 79013654
(2R)-2-(cyanomethylsulfonylamino)-3-methylbutanoic acid (PubChem CID 79013654) has the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. Its IUPAC name is (2R)-2-(cyanomethylsulfonylamino)-3-methylbutanoic acid.
| Compound Name | (2R)-2-(cyanomethylsulfonylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79013654 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (2R)-2-(cyanomethylsulfonylamino)-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NS(=O)(=O)CC#N)C(=O)O |
| InChI | InChI=1S/C7H12N2O4S/c1-5(2)6(7(10)11)9-14(12,13)4-3-8/h5-6,9H,4H2,1-2H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | LDVCJLJOWBWUMQ-ZCFIWIBFSA-N |
| XLogP | -0.46 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |