C10H21NO5S — CID 122067962
2-(4-methoxybutylsulfonylamino)-3-methylbutanoic acid (PubChem CID 122067962) has the molecular formula C10H21NO5S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-(4-methoxybutylsulfonylamino)-3-methylbutanoic acid.
| Compound Name | 2-(4-methoxybutylsulfonylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122067962 |
| Molecular Formula | C10H21NO5S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(4-methoxybutylsulfonylamino)-3-methylbutanoic acid |
| SMILES | COCCCCS(=O)(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C10H21NO5S/c1-8(2)9(10(12)13)11-17(14,15)7-5-4-6-16-3/h8-9,11H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | WCGHBTCDAXGMAO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|