C6H10N2O5S — CID 104965161
(2S,3R)-2-(cyanomethylsulfonylamino)-3-hydroxybutanoic acid (PubChem CID 104965161) has the molecular formula C6H10N2O5S and a molecular weight of 222.22 g/mol. Its IUPAC name is (2S,3R)-2-(cyanomethylsulfonylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(cyanomethylsulfonylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104965161 |
| Molecular Formula | C6H10N2O5S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | (2S,3R)-2-(cyanomethylsulfonylamino)-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NS(=O)(=O)CC#N)C(=O)O |
| InChI | InChI=1S/C6H10N2O5S/c1-4(9)5(6(10)11)8-14(12,13)3-2-7/h4-5,8-9H,3H2,1H3,(H,10,11)/t4-,5+/m1/s1 |
| InChIKey | KJQIXUYWEZPOHS-UHNVWZDZSA-N |
| XLogP | -1.74 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |