C10H19NO6S2 — CID 43351320
2-[(1,1-dioxothiolan-3-yl)sulfonylamino]-3-methylpentanoic acid (PubChem CID 43351320) has the molecular formula C10H19NO6S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)sulfonylamino]-3-methylpentanoic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)sulfonylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 43351320 |
| Molecular Formula | C10H19NO6S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)sulfonylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NS(=O)(=O)C1CCS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C10H19NO6S2/c1-3-7(2)9(10(12)13)11-19(16,17)8-4-5-18(14,15)6-8/h7-9,11H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | CDHBAOSYRBXQBS-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |