(2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid

C10H19NO6S2 — CID 107144936

IUPAC(2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid
SMILESCCCC[C@H](NS(=O)(=O)C1CCS(=O)(=O)C1)C(=O)O
InChIInChI=1S/C10H19NO6S2/c1-2-3-4-9(10(12)13)11-19(16,17)8-5-6-18(14,15)7-8/h8-9,11H,2-7H2,1H3,(H,12,13)/t8?,9-/m0/s1
InChIKeyYZEKPMRIPRFRRA-GKAPJAKFSA-N
MW313.40 g/mol
LogP-0.26
Rot. Bonds7

About (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid

(2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid (PubChem CID 107144936) has the molecular formula C10H19NO6S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid.

Molecular Properties

Compound Name(2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid
PubChem CID107144936
Molecular FormulaC10H19NO6S2
Molecular Weight313.40 g/mol
Exact Mass313.07
IUPAC Name(2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid
SMILESCCCC[C@H](NS(=O)(=O)C1CCS(=O)(=O)C1)C(=O)O
InChIInChI=1S/C10H19NO6S2/c1-2-3-4-9(10(12)13)11-19(16,17)8-5-6-18(14,15)7-8/h8-9,11H,2-7H2,1H3,(H,12,13)/t8?,9-/m0/s1
InChIKeyYZEKPMRIPRFRRA-GKAPJAKFSA-N
XLogP-0.26
TPSA117.61 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.40
LogP ≤ 5-0.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid?
The IUPAC name of (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid (CID 107144936) is (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid.
What is the SMILES notation for (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid?
The canonical SMILES for (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid is CCCC[C@H](NS(=O)(=O)C1CCS(=O)(=O)C1)C(=O)O.
What is the InChIKey of (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid?
The InChIKey is YZEKPMRIPRFRRA-GKAPJAKFSA-N. The full InChI is InChI=1S/C10H19NO6S2/c1-2-3-4-9(10(12)13)11-19(16,17)8-5-6-18(14,15)7-8/h8-9,11H,2-7H2,1H3,(H,12,13)/t8?,9-/m0/s1.
What are the key properties of (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid?
(2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid has a molecular weight of 313.40 g/mol, XLogP of -0.26, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1,1-dioxothiolan-3-yl)sulfonylamino]hexanoic acid is sourced from PubChem (CID 107144936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).