C10H20NO4S+ — CID 3547441
1-carboxypentyl-(1,1-dioxothiolan-3-yl)azanium (PubChem CID 3547441) has the molecular formula C10H20NO4S+ and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-carboxypentyl-(1,1-dioxothiolan-3-yl)azanium.
| Compound Name | 1-carboxypentyl-(1,1-dioxothiolan-3-yl)azanium |
|---|---|
| PubChem CID | 3547441 |
| Molecular Formula | C10H20NO4S+ |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-carboxypentyl-(1,1-dioxothiolan-3-yl)azanium |
| SMILES | CCCCC([NH2+]C1CCS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C10H19NO4S/c1-2-3-4-9(10(12)13)11-8-5-6-16(14,15)7-8/h8-9,11H,2-7H2,1H3,(H,12,13)/p+1 |
| InChIKey | ICGVLMZRVUOAQK-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |