C11H21NO4S — CID 102884394
2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)hexanoic acid (PubChem CID 102884394) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)hexanoic acid.
| Compound Name | 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)hexanoic acid |
|---|---|
| PubChem CID | 102884394 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)hexanoic acid |
| SMILES | CCCCC(C(=O)O)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C11H21NO4S/c1-3-4-5-10(11(13)14)12-6-7-17(15,16)8-9(12)2/h9-10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | OKDLUKJNZHQAIT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |