C9H19NO3S — CID 102885599
3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol (PubChem CID 102885599) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol.
| Compound Name | 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol |
|---|---|
| PubChem CID | 102885599 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol |
| SMILES | CC(O)C(C)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C9H19NO3S/c1-7-6-14(12,13)5-4-10(7)8(2)9(3)11/h7-9,11H,4-6H2,1-3H3 |
| InChIKey | IJSFWUANQGUIGA-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |