C12H26N2O2S — CID 102884168
7-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)heptan-1-amine (PubChem CID 102884168) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 7-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)heptan-1-amine.
| Compound Name | 7-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)heptan-1-amine |
|---|---|
| PubChem CID | 102884168 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 7-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)heptan-1-amine |
| SMILES | CC1CS(=O)(=O)CCN1CCCCCCCN |
| InChI | InChI=1S/C12H26N2O2S/c1-12-11-17(15,16)10-9-14(12)8-6-4-2-3-5-7-13/h12H,2-11,13H2,1H3 |
| InChIKey | QPVZONWNJWJTRI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|