C8H16N4O2S — CID 102885976
4-(3-azidopropyl)-3-methyl-1,4-thiazinane 1,1-dioxide (PubChem CID 102885976) has the molecular formula C8H16N4O2S and a molecular weight of 232.31 g/mol. Its IUPAC name is 4-(3-azidopropyl)-3-methyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(3-azidopropyl)-3-methyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 102885976 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-(3-azidopropyl)-3-methyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1CS(=O)(=O)CCN1CCCN=[N+]=[N-] |
| InChI | InChI=1S/C8H16N4O2S/c1-8-7-15(13,14)6-5-12(8)4-2-3-10-11-9/h8H,2-7H2,1H3 |
| InChIKey | IXPCATJQKGAIBI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|