C13H26N2O4S — CID 102886124
2-methyl-2-(methylamino)-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)hexanoic acid (PubChem CID 102886124) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)hexanoic acid.
| Compound Name | 2-methyl-2-(methylamino)-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)hexanoic acid |
|---|---|
| PubChem CID | 102886124 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-methyl-2-(methylamino)-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)hexanoic acid |
| SMILES | CNC(C)(CCCCN1CCS(=O)(=O)CC1C)C(=O)O |
| InChI | InChI=1S/C13H26N2O4S/c1-11-10-20(18,19)9-8-15(11)7-5-4-6-13(2,14-3)12(16)17/h11,14H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | QLCIYLCVETZNOA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|