C11H23NO2S2 — CID 102887575
2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]pentane-1-thiol (PubChem CID 102887575) has the molecular formula C11H23NO2S2 and a molecular weight of 265.44 g/mol. Its IUPAC name is 2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]pentane-1-thiol.
| Compound Name | 2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]pentane-1-thiol |
|---|---|
| PubChem CID | 102887575 |
| Molecular Formula | C11H23NO2S2 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]pentane-1-thiol |
| SMILES | CCCC(CS)CN1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C11H23NO2S2/c1-3-4-11(8-15)7-12-5-6-16(13,14)9-10(12)2/h10-11,15H,3-9H2,1-2H3 |
| InChIKey | ILJOVOBPGYXAQP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|