C14H30N2S — CID 114086771
2-[(2-ethyl-4-methyl-1,4-diazepan-1-yl)methyl]pentane-1-thiol (PubChem CID 114086771) has the molecular formula C14H30N2S and a molecular weight of 258.47 g/mol. Its IUPAC name is 2-[(2-ethyl-4-methyl-1,4-diazepan-1-yl)methyl]pentane-1-thiol.
| Compound Name | 2-[(2-ethyl-4-methyl-1,4-diazepan-1-yl)methyl]pentane-1-thiol |
|---|---|
| PubChem CID | 114086771 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-[(2-ethyl-4-methyl-1,4-diazepan-1-yl)methyl]pentane-1-thiol |
| SMILES | CCCC(CS)CN1CCCN(C)CC1CC |
| InChI | InChI=1S/C14H30N2S/c1-4-7-13(12-17)10-16-9-6-8-15(3)11-14(16)5-2/h13-14,17H,4-12H2,1-3H3 |
| InChIKey | AAFMDYIVNDZAKQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|