C10H22N2 — CID 21389198
2,6-diethyl-1,4-dimethylpiperazine (PubChem CID 21389198) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,6-diethyl-1,4-dimethylpiperazine.
| Compound Name | 2,6-diethyl-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 21389198 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2,6-diethyl-1,4-dimethylpiperazine |
| SMILES | CCC1CN(C)CC(CC)N1C |
| InChI | InChI=1S/C10H22N2/c1-5-9-7-11(3)8-10(6-2)12(9)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | KCYQJTPTODQXLK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |