C11H23N — CID 146499185
2,7-diethyl-1-methylazepane (PubChem CID 146499185) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 2,7-diethyl-1-methylazepane.
| Compound Name | 2,7-diethyl-1-methylazepane |
|---|---|
| PubChem CID | 146499185 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 2,7-diethyl-1-methylazepane |
| SMILES | CCC1CCCCC(CC)N1C |
| InChI | InChI=1S/C11H23N/c1-4-10-8-6-7-9-11(5-2)12(10)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | XIJHZMHDIFTPBM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |