C18H36N2 — CID 159513333
(2R,3aS,7aS)-2-ethyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole;(2R)-2-ethyl-1-methylpyrrolidine (PubChem CID 159513333) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is (2R,3aS,7aS)-2-ethyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole;(2R)-2-ethyl-1-methylpyrrolidine.
| Compound Name | (2R,3aS,7aS)-2-ethyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole;(2R)-2-ethyl-1-methylpyrrolidine |
|---|---|
| PubChem CID | 159513333 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | (2R,3aS,7aS)-2-ethyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole;(2R)-2-ethyl-1-methylpyrrolidine |
| SMILES | CC[C@@H]1CCCN1C.CC[C@@H]1C[C@@H]2CCCC[C@@H]2N1C |
| InChI | InChI=1S/C11H21N.C7H15N/c1-3-10-8-9-6-4-5-7-11(9)12(10)2;1-3-7-5-4-6-8(7)2/h9-11H,3-8H2,1-2H3;7H,3-6H2,1-2H3/t9-,10+,11-;7-/m01/s1 |
| InChIKey | MAWLBNRNSHSEOA-APZZFUDNSA-N |
| XLogP | 4.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |