C11H26N2 — CID 143144472
propane;(2R)-1,2,4,6-tetramethylpiperazine (PubChem CID 143144472) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is propane;(2R)-1,2,4,6-tetramethylpiperazine.
| Compound Name | propane;(2R)-1,2,4,6-tetramethylpiperazine |
|---|---|
| PubChem CID | 143144472 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | propane;(2R)-1,2,4,6-tetramethylpiperazine |
| SMILES | CC1CN(C)C[C@@H](C)N1C.CCC |
| InChI | InChI=1S/C8H18N2.C3H8/c1-7-5-9(3)6-8(2)10(7)4;1-3-2/h7-8H,5-6H2,1-4H3;3H2,1-2H3/t7-,8?;/m1./s1 |
| InChIKey | SAXLJQKWOIPUNZ-PGMKYVDRSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |