C12H28N2 — CID 171506336
ethane;(2R)-2,4,6-trimethyl-1-propan-2-ylpiperazine (PubChem CID 171506336) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is ethane;(2R)-2,4,6-trimethyl-1-propan-2-ylpiperazine.
| Compound Name | ethane;(2R)-2,4,6-trimethyl-1-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 171506336 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | ethane;(2R)-2,4,6-trimethyl-1-propan-2-ylpiperazine |
| SMILES | CC.CC(C)N1C(C)CN(C)C[C@H]1C |
| InChI | InChI=1S/C10H22N2.C2H6/c1-8(2)12-9(3)6-11(5)7-10(12)4;1-2/h8-10H,6-7H2,1-5H3;1-2H3/t9-,10?;/m1./s1 |
| InChIKey | HJAMSLBARSDOCK-UVUXOWFKSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |