C36H78N6 — CID 161123117
(2S,3R)-2,3-dimethyl-1,4-di(propan-2-yl)piperazine;bis((2S,6R)-2,6-dimethyl-1,4-di(propan-2-yl)piperazine) (PubChem CID 161123117) has the molecular formula C36H78N6 and a molecular weight of 595.06 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethyl-1,4-di(propan-2-yl)piperazine;bis((2S,6R)-2,6-dimethyl-1,4-di(propan-2-yl)piperazine).
| Compound Name | (2S,3R)-2,3-dimethyl-1,4-di(propan-2-yl)piperazine;bis((2S,6R)-2,6-dimethyl-1,4-di(propan-2-yl)piperazine) |
|---|---|
| PubChem CID | 161123117 |
| Molecular Formula | C36H78N6 |
| Molecular Weight | 595.06 g/mol |
| Exact Mass | 594.63 |
| IUPAC Name | (2S,3R)-2,3-dimethyl-1,4-di(propan-2-yl)piperazine;bis((2S,6R)-2,6-dimethyl-1,4-di(propan-2-yl)piperazine) |
| SMILES | CC(C)N1CCN(C(C)C)[C@@H](C)[C@H]1C.CC(C)N1C[C@@H](C)N(C(C)C)[C@@H](C)C1.CC(C)N1C[C@@H](C)N(C(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/3C12H26N2/c2*1-9(2)13-7-11(5)14(10(3)4)12(6)8-13;1-9(2)13-7-8-14(10(3)4)12(6)11(13)5/h3*9-12H,7-8H2,1-6H3/t3*11-,12+ |
| InChIKey | ULFBKIHMOXGYSG-XLYRLNFPSA-N |
| XLogP | 6.59 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.06 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |