About 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine
2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine (PubChem CID 159786270) has the molecular formula C20H43N3
and a molecular weight of 325.59 g/mol. Its IUPAC name is 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine.
Molecular Properties
| Compound Name | 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine |
| PubChem CID | 159786270 |
| Molecular Formula | C20H43N3 |
| Molecular Weight | 325.59 g/mol |
| Exact Mass | 325.35 |
| IUPAC Name | 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine |
| SMILES | CC(C)N1CC1C.CC(C)N1CCC1C.CC1CN(C(C)C)C1 |
| InChI | InChI=1S/2C7H15N.C6H13N/c1-6(2)8-4-7(3)5-8;1-6(2)8-5-4-7(8)3;1-5(2)7-4-6(7)3/h2*6-7H,4-5H2,1-3H3;5-6H,4H2,1-3H3 |
| InChIKey | NHZHXMWZQYNGPM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine?
The IUPAC name of 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine (CID 159786270) is 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine.
What is the SMILES notation for 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine?
The canonical SMILES for 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine is CC(C)N1CC1C.CC(C)N1CCC1C.CC1CN(C(C)C)C1.
What is the InChIKey of 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine?
The InChIKey is NHZHXMWZQYNGPM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H15N.C6H13N/c1-6(2)8-4-7(3)5-8;1-6(2)8-5-4-7(8)3;1-5(2)7-4-6(7)3/h2*6-7H,4-5H2,1-3H3;5-6H,4H2,1-3H3.
What are the key properties of 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine?
2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine has a molecular weight of 325.59 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-propan-2-ylazetidine;3-methyl-1-propan-2-ylazetidine;2-methyl-1-propan-2-ylaziridine is sourced from PubChem (CID 159786270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).