C15H32N2 — CID 138722839
2-methyl-1,4-di(propan-2-yl)-6-propyl-1,4-diazepane (PubChem CID 138722839) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 2-methyl-1,4-di(propan-2-yl)-6-propyl-1,4-diazepane.
| Compound Name | 2-methyl-1,4-di(propan-2-yl)-6-propyl-1,4-diazepane |
|---|---|
| PubChem CID | 138722839 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 2-methyl-1,4-di(propan-2-yl)-6-propyl-1,4-diazepane |
| SMILES | CCCC1CN(C(C)C)CC(C)N(C(C)C)C1 |
| InChI | InChI=1S/C15H32N2/c1-7-8-15-10-16(12(2)3)9-14(6)17(11-15)13(4)5/h12-15H,7-11H2,1-6H3 |
| InChIKey | PYWKUMFRDKBGEI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |