C15H38N2 — CID 170737880
ethane;1-ethyl-2,4,6-trimethylpiperazine (PubChem CID 170737880) has the molecular formula C15H38N2 and a molecular weight of 246.48 g/mol. Its IUPAC name is ethane;1-ethyl-2,4,6-trimethylpiperazine.
| Compound Name | ethane;1-ethyl-2,4,6-trimethylpiperazine |
|---|---|
| PubChem CID | 170737880 |
| Molecular Formula | C15H38N2 |
| Molecular Weight | 246.48 g/mol |
| Exact Mass | 246.30 |
| IUPAC Name | ethane;1-ethyl-2,4,6-trimethylpiperazine |
| SMILES | CC.CC.CC.CCN1C(C)CN(C)CC1C |
| InChI | InChI=1S/C9H20N2.3C2H6/c1-5-11-8(2)6-10(4)7-9(11)3;3*1-2/h8-9H,5-7H2,1-4H3;3*1-2H3 |
| InChIKey | DVIHPRKFHHCAHS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |