C11H26N2 — CID 145006849
ethane;1-ethyl-2,4,6-trimethylpiperazine (PubChem CID 145006849) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is ethane;1-ethyl-2,4,6-trimethylpiperazine.
| Compound Name | ethane;1-ethyl-2,4,6-trimethylpiperazine |
|---|---|
| PubChem CID | 145006849 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | ethane;1-ethyl-2,4,6-trimethylpiperazine |
| SMILES | CC.CCN1C(C)CN(C)CC1C |
| InChI | InChI=1S/C9H20N2.C2H6/c1-5-11-8(2)6-10(4)7-9(11)3;1-2/h8-9H,5-7H2,1-4H3;1-2H3 |
| InChIKey | SNSZFTLWEVDZPE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |