About (2S)-2-ethenyl-1,4,6-trimethylpiperazine
(2S)-2-ethenyl-1,4,6-trimethylpiperazine (PubChem CID 167282263) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (2S)-2-ethenyl-1,4,6-trimethylpiperazine.
Molecular Properties
| Compound Name | (2S)-2-ethenyl-1,4,6-trimethylpiperazine |
| PubChem CID | 167282263 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (2S)-2-ethenyl-1,4,6-trimethylpiperazine |
| SMILES | C=C[C@H]1CN(C)CC(C)N1C |
| InChI | InChI=1S/C9H18N2/c1-5-9-7-10(3)6-8(2)11(9)4/h5,8-9H,1,6-7H2,2-4H3/t8?,9-/m0/s1 |
| InChIKey | GRCWZNKJGUHAJM-GKAPJAKFSA-N |
| XLogP | 0.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-ethenyl-1,4,6-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethenyl-1,4,6-trimethylpiperazine?
The IUPAC name of (2S)-2-ethenyl-1,4,6-trimethylpiperazine (CID 167282263) is (2S)-2-ethenyl-1,4,6-trimethylpiperazine.
What is the SMILES notation for (2S)-2-ethenyl-1,4,6-trimethylpiperazine?
The canonical SMILES for (2S)-2-ethenyl-1,4,6-trimethylpiperazine is C=C[C@H]1CN(C)CC(C)N1C.
What is the InChIKey of (2S)-2-ethenyl-1,4,6-trimethylpiperazine?
The InChIKey is GRCWZNKJGUHAJM-GKAPJAKFSA-N. The full InChI is InChI=1S/C9H18N2/c1-5-9-7-10(3)6-8(2)11(9)4/h5,8-9H,1,6-7H2,2-4H3/t8?,9-/m0/s1.
What are the key properties of (2S)-2-ethenyl-1,4,6-trimethylpiperazine?
(2S)-2-ethenyl-1,4,6-trimethylpiperazine has a molecular weight of 154.26 g/mol, XLogP of 0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethenyl-1,4,6-trimethylpiperazine is sourced from PubChem (CID 167282263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).