C9H18N2 — CID 167282263
(2S)-2-ethenyl-1,4,6-trimethylpiperazine (PubChem CID 167282263) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (2S)-2-ethenyl-1,4,6-trimethylpiperazine.
| Compound Name | (2S)-2-ethenyl-1,4,6-trimethylpiperazine |
|---|---|
| PubChem CID | 167282263 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (2S)-2-ethenyl-1,4,6-trimethylpiperazine |
| SMILES | C=C[C@H]1CN(C)CC(C)N1C |
| InChI | InChI=1S/C9H18N2/c1-5-9-7-10(3)6-8(2)11(9)4/h5,8-9H,1,6-7H2,2-4H3/t8?,9-/m0/s1 |
| InChIKey | GRCWZNKJGUHAJM-GKAPJAKFSA-N |
| XLogP | 0.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|