C8H18N2 — CID 66739096
2-ethyl-1,3,4-trimethylimidazolidine (PubChem CID 66739096) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 2-ethyl-1,3,4-trimethylimidazolidine.
| Compound Name | 2-ethyl-1,3,4-trimethylimidazolidine |
|---|---|
| PubChem CID | 66739096 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2-ethyl-1,3,4-trimethylimidazolidine |
| SMILES | CCC1N(C)CC(C)N1C |
| InChI | InChI=1S/C8H18N2/c1-5-8-9(3)6-7(2)10(8)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | LLTLVSUMJNRKPD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |