C14H29N3 — CID 114086520
2-ethyl-4-methyl-1-(piperidin-3-ylmethyl)-1,4-diazepane (PubChem CID 114086520) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1-(piperidin-3-ylmethyl)-1,4-diazepane.
| Compound Name | 2-ethyl-4-methyl-1-(piperidin-3-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 114086520 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 2-ethyl-4-methyl-1-(piperidin-3-ylmethyl)-1,4-diazepane |
| SMILES | CCC1CN(C)CCCN1CC1CCCNC1 |
| InChI | InChI=1S/C14H29N3/c1-3-14-12-16(2)8-5-9-17(14)11-13-6-4-7-15-10-13/h13-15H,3-12H2,1-2H3 |
| InChIKey | INBPQMRGVOHTQA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |